C7H13NO4S — CID 175027298
azane;2-methyl-4-methylidene-3-oxocyclopentane-1-sulfonic acid (PubChem CID 175027298) has the molecular formula C7H13NO4S and a molecular weight of 207.25 g/mol. Its IUPAC name is azane;2-methyl-4-methylidene-3-oxocyclopentane-1-sulfonic acid.
| Compound Name | azane;2-methyl-4-methylidene-3-oxocyclopentane-1-sulfonic acid |
|---|---|
| PubChem CID | 175027298 |
| Molecular Formula | C7H13NO4S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | azane;2-methyl-4-methylidene-3-oxocyclopentane-1-sulfonic acid |
| SMILES | C=C1CC(S(=O)(=O)O)C(C)C1=O.N |
| InChI | InChI=1S/C7H10O4S.H3N/c1-4-3-6(12(9,10)11)5(2)7(4)8;/h5-6H,1,3H2,2H3,(H,9,10,11);1H3 |
| InChIKey | APEQEPCFHYIGMN-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 106.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|