azane;2-methyl-4-methylidene-3-oxocyclopentane-1-sulfonic acid

C7H13NO4S — CID 175027298

IUPACazane;2-methyl-4-methylidene-3-oxocyclopentane-1-sulfonic acid
SMILESC=C1CC(S(=O)(=O)O)C(C)C1=O.N
InChIInChI=1S/C7H10O4S.H3N/c1-4-3-6(12(9,10)11)5(2)7(4)8;/h5-6H,1,3H2,2H3,(H,9,10,11);1H3
InChIKeyAPEQEPCFHYIGMN-UHFFFAOYSA-N
MW207.25 g/mol
LogP0.57
Rot. Bonds1

About azane;2-methyl-4-methylidene-3-oxocyclopentane-1-sulfonic acid

azane;2-methyl-4-methylidene-3-oxocyclopentane-1-sulfonic acid (PubChem CID 175027298) has the molecular formula C7H13NO4S and a molecular weight of 207.25 g/mol. Its IUPAC name is azane;2-methyl-4-methylidene-3-oxocyclopentane-1-sulfonic acid.

Molecular Properties

Compound Nameazane;2-methyl-4-methylidene-3-oxocyclopentane-1-sulfonic acid
PubChem CID175027298
Molecular FormulaC7H13NO4S
Molecular Weight207.25 g/mol
Exact Mass207.06
IUPAC Nameazane;2-methyl-4-methylidene-3-oxocyclopentane-1-sulfonic acid
SMILESC=C1CC(S(=O)(=O)O)C(C)C1=O.N
InChIInChI=1S/C7H10O4S.H3N/c1-4-3-6(12(9,10)11)5(2)7(4)8;/h5-6H,1,3H2,2H3,(H,9,10,11);1H3
InChIKeyAPEQEPCFHYIGMN-UHFFFAOYSA-N
XLogP0.57
TPSA106.44 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.25
LogP ≤ 50.57
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze azane;2-methyl-4-methylidene-3-oxocyclopentane-1-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of azane;2-methyl-4-methylidene-3-oxocyclopentane-1-sulfonic acid?
The IUPAC name of azane;2-methyl-4-methylidene-3-oxocyclopentane-1-sulfonic acid (CID 175027298) is azane;2-methyl-4-methylidene-3-oxocyclopentane-1-sulfonic acid.
What is the SMILES notation for azane;2-methyl-4-methylidene-3-oxocyclopentane-1-sulfonic acid?
The canonical SMILES for azane;2-methyl-4-methylidene-3-oxocyclopentane-1-sulfonic acid is C=C1CC(S(=O)(=O)O)C(C)C1=O.N.
What is the InChIKey of azane;2-methyl-4-methylidene-3-oxocyclopentane-1-sulfonic acid?
The InChIKey is APEQEPCFHYIGMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O4S.H3N/c1-4-3-6(12(9,10)11)5(2)7(4)8;/h5-6H,1,3H2,2H3,(H,9,10,11);1H3.
What are the key properties of azane;2-methyl-4-methylidene-3-oxocyclopentane-1-sulfonic acid?
azane;2-methyl-4-methylidene-3-oxocyclopentane-1-sulfonic acid has a molecular weight of 207.25 g/mol, XLogP of 0.57, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-methyl-4-methylidene-3-oxocyclopentane-1-sulfonic acid is sourced from PubChem (CID 175027298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).