C30H30S — CID 175031747
2-phenyl-3,4-bis(2-phenylpropan-2-yl)benzenethiol (PubChem CID 175031747) has the molecular formula C30H30S and a molecular weight of 422.64 g/mol. Its IUPAC name is 2-phenyl-3,4-bis(2-phenylpropan-2-yl)benzenethiol.
| Compound Name | 2-phenyl-3,4-bis(2-phenylpropan-2-yl)benzenethiol |
|---|---|
| PubChem CID | 175031747 |
| Molecular Formula | C30H30S |
| Molecular Weight | 422.64 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 2-phenyl-3,4-bis(2-phenylpropan-2-yl)benzenethiol |
| SMILES | CC(C)(c1ccccc1)c1ccc(S)c(-c2ccccc2)c1C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C30H30S/c1-29(2,23-16-10-6-11-17-23)25-20-21-26(31)27(22-14-8-5-9-15-22)28(25)30(3,4)24-18-12-7-13-19-24/h5-21,31H,1-4H3 |
| InChIKey | YEKXPBWISAAXBB-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.64 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|