C30H14Cl4N2 — CID 175035431
2-(3,4,5,6-tetrachloro-1-pyridin-2-ylperylen-2-yl)pyridine (PubChem CID 175035431) has the molecular formula C30H14Cl4N2 and a molecular weight of 544.27 g/mol. Its IUPAC name is 2-(3,4,5,6-tetrachloro-1-pyridin-2-ylperylen-2-yl)pyridine.
| Compound Name | 2-(3,4,5,6-tetrachloro-1-pyridin-2-ylperylen-2-yl)pyridine |
|---|---|
| PubChem CID | 175035431 |
| Molecular Formula | C30H14Cl4N2 |
| Molecular Weight | 544.27 g/mol |
| Exact Mass | 541.99 |
| IUPAC Name | 2-(3,4,5,6-tetrachloro-1-pyridin-2-ylperylen-2-yl)pyridine |
| SMILES | Clc1c(Cl)c2c(Cl)c(-c3ccccn3)c(-c3ccccn3)c3c4cccc5cccc(c(c1Cl)c23)c54 |
| InChI | InChI=1S/C30H14Cl4N2/c31-27-24(19-12-2-4-14-36-19)23(18-11-1-3-13-35-18)21-16-9-5-7-15-8-6-10-17(20(15)16)22-25(21)26(27)29(33)30(34)28(22)32/h1-14H |
| InChIKey | FOABHMDBPAEWOK-UHFFFAOYSA-N |
| XLogP | 10.47 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.27 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|