C31H36O2 — CID 175039067
[1-ethyl-3-methyl-2,2-diphenyl-4-(1-phenylethyl)cyclohexyl] acetate (PubChem CID 175039067) has the molecular formula C31H36O2 and a molecular weight of 440.63 g/mol. Its IUPAC name is [1-ethyl-3-methyl-2,2-diphenyl-4-(1-phenylethyl)cyclohexyl] acetate.
| Compound Name | [1-ethyl-3-methyl-2,2-diphenyl-4-(1-phenylethyl)cyclohexyl] acetate |
|---|---|
| PubChem CID | 175039067 |
| Molecular Formula | C31H36O2 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | [1-ethyl-3-methyl-2,2-diphenyl-4-(1-phenylethyl)cyclohexyl] acetate |
| SMILES | CCC1(OC(C)=O)CCC(C(C)c2ccccc2)C(C)C1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H36O2/c1-5-30(33-25(4)32)22-21-29(23(2)26-15-9-6-10-16-26)24(3)31(30,27-17-11-7-12-18-27)28-19-13-8-14-20-28/h6-20,23-24,29H,5,21-22H2,1-4H3 |
| InChIKey | BUBBAZCREQKKOA-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |