About 2-methylpropyl 3-[2-[(6-chloro-1,3-benzothiazole-2-carbonyl)amino]imidazol-1-yl]propanoate
2-methylpropyl 3-[2-[(6-chloro-1,3-benzothiazole-2-carbonyl)amino]imidazol-1-yl]propanoate (PubChem CID 175039155) has the molecular formula C18H19ClN4O3S
and a molecular weight of 406.90 g/mol. Its IUPAC name is 2-methylpropyl 3-[2-[(6-chloro-1,3-benzothiazole-2-carbonyl)amino]imidazol-1-yl]propanoate.
Molecular Properties
| Compound Name | 2-methylpropyl 3-[2-[(6-chloro-1,3-benzothiazole-2-carbonyl)amino]imidazol-1-yl]propanoate |
| PubChem CID | 175039155 |
| Molecular Formula | C18H19ClN4O3S |
| Molecular Weight | 406.90 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 2-methylpropyl 3-[2-[(6-chloro-1,3-benzothiazole-2-carbonyl)amino]imidazol-1-yl]propanoate |
| SMILES | CC(C)COC(=O)CCn1ccnc1NC(=O)c1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C18H19ClN4O3S/c1-11(2)10-26-15(24)5-7-23-8-6-20-18(23)22-16(25)17-21-13-4-3-12(19)9-14(13)27-17/h3-4,6,8-9,11H,5,7,10H2,1-2H3,(H,20,22,25) |
| InChIKey | OYXQLDHTSWCCSY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.90 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-methylpropyl 3-[2-[(6-chloro-1,3-benzothiazole-2-carbonyl)amino]imidazol-1-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 3-[2-[(6-chloro-1,3-benzothiazole-2-carbonyl)amino]imidazol-1-yl]propanoate?
The IUPAC name of 2-methylpropyl 3-[2-[(6-chloro-1,3-benzothiazole-2-carbonyl)amino]imidazol-1-yl]propanoate (CID 175039155) is 2-methylpropyl 3-[2-[(6-chloro-1,3-benzothiazole-2-carbonyl)amino]imidazol-1-yl]propanoate.
What is the SMILES notation for 2-methylpropyl 3-[2-[(6-chloro-1,3-benzothiazole-2-carbonyl)amino]imidazol-1-yl]propanoate?
The canonical SMILES for 2-methylpropyl 3-[2-[(6-chloro-1,3-benzothiazole-2-carbonyl)amino]imidazol-1-yl]propanoate is CC(C)COC(=O)CCn1ccnc1NC(=O)c1nc2ccc(Cl)cc2s1.
What is the InChIKey of 2-methylpropyl 3-[2-[(6-chloro-1,3-benzothiazole-2-carbonyl)amino]imidazol-1-yl]propanoate?
The InChIKey is OYXQLDHTSWCCSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19ClN4O3S/c1-11(2)10-26-15(24)5-7-23-8-6-20-18(23)22-16(25)17-21-13-4-3-12(19)9-14(13)27-17/h3-4,6,8-9,11H,5,7,10H2,1-2H3,(H,20,22,25).
What are the key properties of 2-methylpropyl 3-[2-[(6-chloro-1,3-benzothiazole-2-carbonyl)amino]imidazol-1-yl]propanoate?
2-methylpropyl 3-[2-[(6-chloro-1,3-benzothiazole-2-carbonyl)amino]imidazol-1-yl]propanoate has a molecular weight of 406.90 g/mol, XLogP of 3.99, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 3-[2-[(6-chloro-1,3-benzothiazole-2-carbonyl)amino]imidazol-1-yl]propanoate is sourced from PubChem (CID 175039155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).