C19H20Cl3NO3 — CID 175039862
N-methoxy-5-phenylmethoxy-4-(2,4,5-trichlorophenoxy)pentan-1-imine (PubChem CID 175039862) has the molecular formula C19H20Cl3NO3 and a molecular weight of 416.73 g/mol. Its IUPAC name is N-methoxy-5-phenylmethoxy-4-(2,4,5-trichlorophenoxy)pentan-1-imine.
| Compound Name | N-methoxy-5-phenylmethoxy-4-(2,4,5-trichlorophenoxy)pentan-1-imine |
|---|---|
| PubChem CID | 175039862 |
| Molecular Formula | C19H20Cl3NO3 |
| Molecular Weight | 416.73 g/mol |
| Exact Mass | 415.05 |
| IUPAC Name | N-methoxy-5-phenylmethoxy-4-(2,4,5-trichlorophenoxy)pentan-1-imine |
| SMILES | CON=CCCC(COCc1ccccc1)Oc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C19H20Cl3NO3/c1-24-23-9-5-8-15(13-25-12-14-6-3-2-4-7-14)26-19-11-17(21)16(20)10-18(19)22/h2-4,6-7,9-11,15H,5,8,12-13H2,1H3 |
| InChIKey | AGRIROTYWQEEJD-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.73 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|