C26H25Cl3FNO4 — CID 118108932
(E,2R,3R,4R)-2-fluoro-N-methoxy-3,5-bis(phenylmethoxy)-4-(2,4,5-trichlorophenoxy)pentan-1-imine (PubChem CID 118108932) has the molecular formula C26H25Cl3FNO4 and a molecular weight of 540.85 g/mol. Its IUPAC name is (E,2R,3R,4R)-2-fluoro-N-methoxy-3,5-bis(phenylmethoxy)-4-(2,4,5-trichlorophenoxy)pentan-1-imine.
| Compound Name | (E,2R,3R,4R)-2-fluoro-N-methoxy-3,5-bis(phenylmethoxy)-4-(2,4,5-trichlorophenoxy)pentan-1-imine |
|---|---|
| PubChem CID | 118108932 |
| Molecular Formula | C26H25Cl3FNO4 |
| Molecular Weight | 540.85 g/mol |
| Exact Mass | 539.08 |
| IUPAC Name | (E,2R,3R,4R)-2-fluoro-N-methoxy-3,5-bis(phenylmethoxy)-4-(2,4,5-trichlorophenoxy)pentan-1-imine |
| SMILES | CO/N=C/[C@@H](F)[C@H](OCc1ccccc1)[C@@H](COCc1ccccc1)Oc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C26H25Cl3FNO4/c1-32-31-14-23(30)26(34-16-19-10-6-3-7-11-19)25(17-33-15-18-8-4-2-5-9-18)35-24-13-21(28)20(27)12-22(24)29/h2-14,23,25-26H,15-17H2,1H3/b31-14+/t23-,25-,26+/m1/s1 |
| InChIKey | VYCYMQNZXXSOHW-WFGWAYBBSA-N |
| XLogP | 7.17 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.85 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|