C27H28Cl3FO5 — CID 118108776
1,2,4-trichloro-5-[(2R,3R,4R)-4-fluoro-1,3-bis[(4-methoxyphenyl)methoxy]pentan-2-yl]oxybenzene (PubChem CID 118108776) has the molecular formula C27H28Cl3FO5 and a molecular weight of 557.87 g/mol. Its IUPAC name is 1,2,4-trichloro-5-[(2R,3R,4R)-4-fluoro-1,3-bis[(4-methoxyphenyl)methoxy]pentan-2-yl]oxybenzene.
| Compound Name | 1,2,4-trichloro-5-[(2R,3R,4R)-4-fluoro-1,3-bis[(4-methoxyphenyl)methoxy]pentan-2-yl]oxybenzene |
|---|---|
| PubChem CID | 118108776 |
| Molecular Formula | C27H28Cl3FO5 |
| Molecular Weight | 557.87 g/mol |
| Exact Mass | 556.10 |
| IUPAC Name | 1,2,4-trichloro-5-[(2R,3R,4R)-4-fluoro-1,3-bis[(4-methoxyphenyl)methoxy]pentan-2-yl]oxybenzene |
| SMILES | COc1ccc(COCC(Oc2cc(Cl)c(Cl)cc2Cl)[C@@H](OCc2ccc(OC)cc2)[C@@H](C)F)cc1 |
| InChI | InChI=1S/C27H28Cl3FO5/c1-17(31)27(35-15-19-6-10-21(33-3)11-7-19)26(36-25-13-23(29)22(28)12-24(25)30)16-34-14-18-4-8-20(32-2)9-5-18/h4-13,17,26-27H,14-16H2,1-3H3/t17-,26?,27+/m1/s1 |
| InChIKey | ZXGVZBAZGOCQEG-HFBJMWPXSA-N |
| XLogP | 7.57 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.87 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|