C22H27BrFNO5 — CID 129299968
(E,2R,3S,4S)-4-bromo-2-fluoro-N-methoxy-3,5-bis[(4-methoxyphenyl)methoxy]pentan-1-imine (PubChem CID 129299968) has the molecular formula C22H27BrFNO5 and a molecular weight of 484.36 g/mol. Its IUPAC name is (E,2R,3S,4S)-4-bromo-2-fluoro-N-methoxy-3,5-bis[(4-methoxyphenyl)methoxy]pentan-1-imine.
| Compound Name | (E,2R,3S,4S)-4-bromo-2-fluoro-N-methoxy-3,5-bis[(4-methoxyphenyl)methoxy]pentan-1-imine |
|---|---|
| PubChem CID | 129299968 |
| Molecular Formula | C22H27BrFNO5 |
| Molecular Weight | 484.36 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | (E,2R,3S,4S)-4-bromo-2-fluoro-N-methoxy-3,5-bis[(4-methoxyphenyl)methoxy]pentan-1-imine |
| SMILES | CO/N=C/[C@@H](F)[C@H](OCc1ccc(OC)cc1)[C@@H](Br)COCc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H27BrFNO5/c1-26-18-8-4-16(5-9-18)13-29-15-20(23)22(21(24)12-25-28-3)30-14-17-6-10-19(27-2)11-7-17/h4-12,20-22H,13-15H2,1-3H3/b25-12+/t20-,21+,22+/m0/s1 |
| InChIKey | KAWVGKXJTXBJPE-KKWLVHLRSA-N |
| XLogP | 4.54 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.36 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|