C20H22Cl2FNO4 — CID 118108782
(2R,3R,4S)-1,3-bis[(4-chlorophenyl)methoxy]-4-fluoro-5-methoxyiminopentan-2-ol (PubChem CID 118108782) has the molecular formula C20H22Cl2FNO4 and a molecular weight of 430.30 g/mol. Its IUPAC name is (2R,3R,4S)-1,3-bis[(4-chlorophenyl)methoxy]-4-fluoro-5-methoxyiminopentan-2-ol.
| Compound Name | (2R,3R,4S)-1,3-bis[(4-chlorophenyl)methoxy]-4-fluoro-5-methoxyiminopentan-2-ol |
|---|---|
| PubChem CID | 118108782 |
| Molecular Formula | C20H22Cl2FNO4 |
| Molecular Weight | 430.30 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | (2R,3R,4S)-1,3-bis[(4-chlorophenyl)methoxy]-4-fluoro-5-methoxyiminopentan-2-ol |
| SMILES | CON=C[C@H](F)[C@H](OCc1ccc(Cl)cc1)[C@H](O)COCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H22Cl2FNO4/c1-26-24-10-18(23)20(28-12-15-4-8-17(22)9-5-15)19(25)13-27-11-14-2-6-16(21)7-3-14/h2-10,18-20,25H,11-13H2,1H3/t18-,19+,20-/m0/s1 |
| InChIKey | MKFVVDQJOMODGW-ZCNNSNEGSA-N |
| XLogP | 4.43 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.30 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|