C12H21N7O4 — CID 175044198
(2S)-2-amino-5-[4-[(2S)-2-amino-2-carboxyethyl]imidazol-1-yl]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 175044198) has the molecular formula C12H21N7O4 and a molecular weight of 327.35 g/mol. Its IUPAC name is (2S)-2-amino-5-[4-[(2S)-2-amino-2-carboxyethyl]imidazol-1-yl]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-amino-5-[4-[(2S)-2-amino-2-carboxyethyl]imidazol-1-yl]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 175044198 |
| Molecular Formula | C12H21N7O4 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | (2S)-2-amino-5-[4-[(2S)-2-amino-2-carboxyethyl]imidazol-1-yl]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(N)=NC(CC[C@H](N)C(=O)O)n1cnc(C[C@H](N)C(=O)O)c1 |
| InChI | InChI=1S/C12H21N7O4/c13-7(10(20)21)1-2-9(18-12(15)16)19-4-6(17-5-19)3-8(14)11(22)23/h4-5,7-9H,1-3,13-14H2,(H,20,21)(H,22,23)(H4,15,16,18)/t7-,8-,9?/m0/s1 |
| InChIKey | CPAJBIRDQJVMBC-JVIMKECRSA-N |
| XLogP | -2.20 |
| TPSA | 208.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|