C12H18N4O4 — CID 91226345
(2S)-5-[4-(2-acetamidoethyl)imidazol-1-yl]-2-amino-5-oxopentanoic acid (PubChem CID 91226345) has the molecular formula C12H18N4O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is (2S)-5-[4-(2-acetamidoethyl)imidazol-1-yl]-2-amino-5-oxopentanoic acid.
| Compound Name | (2S)-5-[4-(2-acetamidoethyl)imidazol-1-yl]-2-amino-5-oxopentanoic acid |
|---|---|
| PubChem CID | 91226345 |
| Molecular Formula | C12H18N4O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | (2S)-5-[4-(2-acetamidoethyl)imidazol-1-yl]-2-amino-5-oxopentanoic acid |
| SMILES | CC(=O)NCCc1cn(C(=O)CC[C@H](N)C(=O)O)cn1 |
| InChI | InChI=1S/C12H18N4O4/c1-8(17)14-5-4-9-6-16(7-15-9)11(18)3-2-10(13)12(19)20/h6-7,10H,2-5,13H2,1H3,(H,14,17)(H,19,20)/t10-/m0/s1 |
| InChIKey | BYLWQSHYZCTVMQ-JTQLQIEISA-N |
| XLogP | -0.61 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |