About bis(4-phenoxyaniline);trimethyl(methylsilyloxy)silane
bis(4-phenoxyaniline);trimethyl(methylsilyloxy)silane (PubChem CID 175052083) has the molecular formula C28H36N2O3Si2
and a molecular weight of 504.78 g/mol. Its IUPAC name is bis(4-phenoxyaniline);trimethyl(methylsilyloxy)silane.
Molecular Properties
| Compound Name | bis(4-phenoxyaniline);trimethyl(methylsilyloxy)silane |
| PubChem CID | 175052083 |
| Molecular Formula | C28H36N2O3Si2 |
| Molecular Weight | 504.78 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | bis(4-phenoxyaniline);trimethyl(methylsilyloxy)silane |
| SMILES | C[SiH2]O[Si](C)(C)C.Nc1ccc(Oc2ccccc2)cc1.Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/2C12H11NO.C4H14OSi2/c2*13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11;1-6-5-7(2,3)4/h2*1-9H,13H2;6H2,1-4H3 |
| InChIKey | VRNKZVZSYJOWJB-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 504.78 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(4-phenoxyaniline);trimethyl(methylsilyloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-phenoxyaniline);trimethyl(methylsilyloxy)silane?
The IUPAC name of bis(4-phenoxyaniline);trimethyl(methylsilyloxy)silane (CID 175052083) is bis(4-phenoxyaniline);trimethyl(methylsilyloxy)silane.
What is the SMILES notation for bis(4-phenoxyaniline);trimethyl(methylsilyloxy)silane?
The canonical SMILES for bis(4-phenoxyaniline);trimethyl(methylsilyloxy)silane is C[SiH2]O[Si](C)(C)C.Nc1ccc(Oc2ccccc2)cc1.Nc1ccc(Oc2ccccc2)cc1.
What is the InChIKey of bis(4-phenoxyaniline);trimethyl(methylsilyloxy)silane?
The InChIKey is VRNKZVZSYJOWJB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H11NO.C4H14OSi2/c2*13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11;1-6-5-7(2,3)4/h2*1-9H,13H2;6H2,1-4H3.
What are the key properties of bis(4-phenoxyaniline);trimethyl(methylsilyloxy)silane?
bis(4-phenoxyaniline);trimethyl(methylsilyloxy)silane has a molecular weight of 504.78 g/mol, XLogP of 7.09, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-phenoxyaniline);trimethyl(methylsilyloxy)silane is sourced from PubChem (CID 175052083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).