C14H9Cl2NO2 — CID 175054494
4-[(2,6-dichlorophenyl)methoxy]-1,2-benzoxazole (PubChem CID 175054494) has the molecular formula C14H9Cl2NO2 and a molecular weight of 294.14 g/mol. Its IUPAC name is 4-[(2,6-dichlorophenyl)methoxy]-1,2-benzoxazole.
| Compound Name | 4-[(2,6-dichlorophenyl)methoxy]-1,2-benzoxazole |
|---|---|
| PubChem CID | 175054494 |
| Molecular Formula | C14H9Cl2NO2 |
| Molecular Weight | 294.14 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | 4-[(2,6-dichlorophenyl)methoxy]-1,2-benzoxazole |
| SMILES | Clc1cccc(Cl)c1COc1cccc2oncc12 |
| InChI | InChI=1S/C14H9Cl2NO2/c15-11-3-1-4-12(16)10(11)8-18-13-5-2-6-14-9(13)7-17-19-14/h1-7H,8H2 |
| InChIKey | LIGBKARUKLLSCD-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.14 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |