C9H12O4 — CID 175055496
3-phenylperoxypropane-1,2-diol (PubChem CID 175055496) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is 3-phenylperoxypropane-1,2-diol.
| Compound Name | 3-phenylperoxypropane-1,2-diol |
|---|---|
| PubChem CID | 175055496 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 3-phenylperoxypropane-1,2-diol |
| SMILES | OCC(O)COOc1ccccc1 |
| InChI | InChI=1S/C9H12O4/c10-6-8(11)7-12-13-9-4-2-1-3-5-9/h1-5,8,10-11H,6-7H2 |
| InChIKey | DOLBTGIMALIBRA-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|