C12H10BrFN2OS — CID 175057361
(1S,5S,6S)-5-(5-bromo-2-fluoro-3-pyridinyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-ene-1-carbaldehyde (PubChem CID 175057361) has the molecular formula C12H10BrFN2OS and a molecular weight of 329.19 g/mol. Its IUPAC name is (1S,5S,6S)-5-(5-bromo-2-fluoro-3-pyridinyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-ene-1-carbaldehyde.
| Compound Name | (1S,5S,6S)-5-(5-bromo-2-fluoro-3-pyridinyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-ene-1-carbaldehyde |
|---|---|
| PubChem CID | 175057361 |
| Molecular Formula | C12H10BrFN2OS |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 327.97 |
| IUPAC Name | (1S,5S,6S)-5-(5-bromo-2-fluoro-3-pyridinyl)-5-methyl-2-thia-4-azabicyclo[4.1.0]hept-3-ene-1-carbaldehyde |
| SMILES | C[C@]1(c2cc(Br)cnc2F)N=CS[C@@]2(C=O)C[C@H]21 |
| InChI | InChI=1S/C12H10BrFN2OS/c1-11(8-2-7(13)4-15-10(8)14)9-3-12(9,5-17)18-6-16-11/h2,4-6,9H,3H2,1H3/t9-,11+,12+/m0/s1 |
| InChIKey | FMIIVTTVEATMNS-MVWJERBFSA-N |
| XLogP | 2.93 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|