C14H15BrFN3O4S — CID 90301289
[7-(5-bromo-2-fluoro-3-pyridinyl)-7-methyl-5,5-dioxo-5λ6-thia-8-azaspiro[3.5]non-8-en-9-yl]carbamic acid (PubChem CID 90301289) has the molecular formula C14H15BrFN3O4S and a molecular weight of 420.26 g/mol. Its IUPAC name is [7-(5-bromo-2-fluoro-3-pyridinyl)-7-methyl-5,5-dioxo-5λ6-thia-8-azaspiro[3.5]non-8-en-9-yl]carbamic acid.
| Compound Name | [7-(5-bromo-2-fluoro-3-pyridinyl)-7-methyl-5,5-dioxo-5λ6-thia-8-azaspiro[3.5]non-8-en-9-yl]carbamic acid |
|---|---|
| PubChem CID | 90301289 |
| Molecular Formula | C14H15BrFN3O4S |
| Molecular Weight | 420.26 g/mol |
| Exact Mass | 419.00 |
| IUPAC Name | [7-(5-bromo-2-fluoro-3-pyridinyl)-7-methyl-5,5-dioxo-5λ6-thia-8-azaspiro[3.5]non-8-en-9-yl]carbamic acid |
| SMILES | CC1(c2cc(Br)cnc2F)CS(=O)(=O)C2(CCC2)C(NC(=O)O)=N1 |
| InChI | InChI=1S/C14H15BrFN3O4S/c1-13(9-5-8(15)6-17-10(9)16)7-24(22,23)14(3-2-4-14)11(19-13)18-12(20)21/h5-6H,2-4,7H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | GFRWSHXODVEJTJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|