C12H21BO5 — CID 175059344
butane-1,3-diol;(3,5-dimethylphenoxy)boronic acid (PubChem CID 175059344) has the molecular formula C12H21BO5 and a molecular weight of 256.11 g/mol. Its IUPAC name is butane-1,3-diol;(3,5-dimethylphenoxy)boronic acid.
| Compound Name | butane-1,3-diol;(3,5-dimethylphenoxy)boronic acid |
|---|---|
| PubChem CID | 175059344 |
| Molecular Formula | C12H21BO5 |
| Molecular Weight | 256.11 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | butane-1,3-diol;(3,5-dimethylphenoxy)boronic acid |
| SMILES | CC(O)CCO.Cc1cc(C)cc(OB(O)O)c1 |
| InChI | InChI=1S/C8H11BO3.C4H10O2/c1-6-3-7(2)5-8(4-6)12-9(10)11;1-4(6)2-3-5/h3-5,10-11H,1-2H3;4-6H,2-3H2,1H3 |
| InChIKey | NYXCEUIXWNTUCJ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.11 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|