butane-1,3-diol;(3,5-dimethylphenoxy)boronic acid

C12H21BO5 — CID 175059344

IUPACbutane-1,3-diol;(3,5-dimethylphenoxy)boronic acid
SMILESCC(O)CCO.Cc1cc(C)cc(OB(O)O)c1
InChIInChI=1S/C8H11BO3.C4H10O2/c1-6-3-7(2)5-8(4-6)12-9(10)11;1-4(6)2-3-5/h3-5,10-11H,1-2H3;4-6H,2-3H2,1H3
InChIKeyNYXCEUIXWNTUCJ-UHFFFAOYSA-N
MW256.11 g/mol
LogP0.40
Rot. Bonds4

About butane-1,3-diol;(3,5-dimethylphenoxy)boronic acid

butane-1,3-diol;(3,5-dimethylphenoxy)boronic acid (PubChem CID 175059344) has the molecular formula C12H21BO5 and a molecular weight of 256.11 g/mol. Its IUPAC name is butane-1,3-diol;(3,5-dimethylphenoxy)boronic acid.

Molecular Properties

Compound Namebutane-1,3-diol;(3,5-dimethylphenoxy)boronic acid
PubChem CID175059344
Molecular FormulaC12H21BO5
Molecular Weight256.11 g/mol
Exact Mass256.15
IUPAC Namebutane-1,3-diol;(3,5-dimethylphenoxy)boronic acid
SMILESCC(O)CCO.Cc1cc(C)cc(OB(O)O)c1
InChIInChI=1S/C8H11BO3.C4H10O2/c1-6-3-7(2)5-8(4-6)12-9(10)11;1-4(6)2-3-5/h3-5,10-11H,1-2H3;4-6H,2-3H2,1H3
InChIKeyNYXCEUIXWNTUCJ-UHFFFAOYSA-N
XLogP0.40
TPSA90.15 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.11
LogP ≤ 50.40
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze butane-1,3-diol;(3,5-dimethylphenoxy)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of butane-1,3-diol;(3,5-dimethylphenoxy)boronic acid?
The IUPAC name of butane-1,3-diol;(3,5-dimethylphenoxy)boronic acid (CID 175059344) is butane-1,3-diol;(3,5-dimethylphenoxy)boronic acid.
What is the SMILES notation for butane-1,3-diol;(3,5-dimethylphenoxy)boronic acid?
The canonical SMILES for butane-1,3-diol;(3,5-dimethylphenoxy)boronic acid is CC(O)CCO.Cc1cc(C)cc(OB(O)O)c1.
What is the InChIKey of butane-1,3-diol;(3,5-dimethylphenoxy)boronic acid?
The InChIKey is NYXCEUIXWNTUCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11BO3.C4H10O2/c1-6-3-7(2)5-8(4-6)12-9(10)11;1-4(6)2-3-5/h3-5,10-11H,1-2H3;4-6H,2-3H2,1H3.
What are the key properties of butane-1,3-diol;(3,5-dimethylphenoxy)boronic acid?
butane-1,3-diol;(3,5-dimethylphenoxy)boronic acid has a molecular weight of 256.11 g/mol, XLogP of 0.40, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butane-1,3-diol;(3,5-dimethylphenoxy)boronic acid is sourced from PubChem (CID 175059344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).