C11H12O2S2 — CID 175063042
bicyclo[3.1.1]hepta-1(6),2,4-triene;2-methyl-3-sulfanyl-3-sulfanylidenepropanoic acid (PubChem CID 175063042) has the molecular formula C11H12O2S2 and a molecular weight of 240.35 g/mol. Its IUPAC name is bicyclo[3.1.1]hepta-1(6),2,4-triene;2-methyl-3-sulfanyl-3-sulfanylidenepropanoic acid.
| Compound Name | bicyclo[3.1.1]hepta-1(6),2,4-triene;2-methyl-3-sulfanyl-3-sulfanylidenepropanoic acid |
|---|---|
| PubChem CID | 175063042 |
| Molecular Formula | C11H12O2S2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | bicyclo[3.1.1]hepta-1(6),2,4-triene;2-methyl-3-sulfanyl-3-sulfanylidenepropanoic acid |
| SMILES | CC(C(=O)O)C(=S)S.c1cc2cc(c1)C2 |
| InChI | InChI=1S/C7H6.C4H6O2S2/c1-2-6-4-7(3-1)5-6;1-2(3(5)6)4(7)8/h1-4H,5H2;2H,1H3,(H,5,6)(H,7,8) |
| InChIKey | QWACNLXKXBMZLF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|