About alumane;2-methoxy-1-phosphorosooxypropane
alumane;2-methoxy-1-phosphorosooxypropane (PubChem CID 175063077) has the molecular formula C4H12AlO3P
and a molecular weight of 166.09 g/mol. Its IUPAC name is alumane;2-methoxy-1-phosphorosooxypropane.
Molecular Properties
| Compound Name | alumane;2-methoxy-1-phosphorosooxypropane |
| PubChem CID | 175063077 |
| Molecular Formula | C4H12AlO3P |
| Molecular Weight | 166.09 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | alumane;2-methoxy-1-phosphorosooxypropane |
| SMILES | COC(C)COP=O.[AlH3] |
| InChI | InChI=1S/C4H9O3P.Al.3H/c1-4(6-2)3-7-8-5;;;;/h4H,3H2,1-2H3;;;; |
| InChIKey | YMUFYGGXXOLIAX-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.09 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze alumane;2-methoxy-1-phosphorosooxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;2-methoxy-1-phosphorosooxypropane?
The IUPAC name of alumane;2-methoxy-1-phosphorosooxypropane (CID 175063077) is alumane;2-methoxy-1-phosphorosooxypropane.
What is the SMILES notation for alumane;2-methoxy-1-phosphorosooxypropane?
The canonical SMILES for alumane;2-methoxy-1-phosphorosooxypropane is COC(C)COP=O.[AlH3].
What is the InChIKey of alumane;2-methoxy-1-phosphorosooxypropane?
The InChIKey is YMUFYGGXXOLIAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9O3P.Al.3H/c1-4(6-2)3-7-8-5;;;;/h4H,3H2,1-2H3;;;;.
What are the key properties of alumane;2-methoxy-1-phosphorosooxypropane?
alumane;2-methoxy-1-phosphorosooxypropane has a molecular weight of 166.09 g/mol, XLogP of 0.06, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;2-methoxy-1-phosphorosooxypropane is sourced from PubChem (CID 175063077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).