C3H6O5P2 — CID 57292886
1,3-diphosphorosooxypropan-2-ol (PubChem CID 57292886) has the molecular formula C3H6O5P2 and a molecular weight of 184.02 g/mol. Its IUPAC name is 1,3-diphosphorosooxypropan-2-ol.
| Compound Name | 1,3-diphosphorosooxypropan-2-ol |
|---|---|
| PubChem CID | 57292886 |
| Molecular Formula | C3H6O5P2 |
| Molecular Weight | 184.02 g/mol |
| Exact Mass | 183.97 |
| IUPAC Name | 1,3-diphosphorosooxypropan-2-ol |
| SMILES | O=POCC(O)COP=O |
| InChI | InChI=1S/C3H6O5P2/c4-3(1-7-9-5)2-8-10-6/h3-4H,1-2H2 |
| InChIKey | VRYZUNOXECJKEY-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.02 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|