C4H9O7P — CID 25163997
[(2R)-2-hydroxy-3-phosphonooxypropyl] formate (PubChem CID 25163997) has the molecular formula C4H9O7P and a molecular weight of 200.08 g/mol. Its IUPAC name is [(2R)-2-hydroxy-3-phosphonooxypropyl] formate.
| Compound Name | [(2R)-2-hydroxy-3-phosphonooxypropyl] formate |
|---|---|
| PubChem CID | 25163997 |
| Molecular Formula | C4H9O7P |
| Molecular Weight | 200.08 g/mol |
| Exact Mass | 200.01 |
| IUPAC Name | [(2R)-2-hydroxy-3-phosphonooxypropyl] formate |
| SMILES | O=COC[C@@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C4H9O7P/c5-3-10-1-4(6)2-11-12(7,8)9/h3-4,6H,1-2H2,(H2,7,8,9)/t4-/m1/s1 |
| InChIKey | FIZSCSXWOJBHKQ-SCSAIBSYSA-N |
| XLogP | -1.37 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.08 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|