C6H15O15P3 — CID 88507978
[(2S,3R,4S)-4,6-dihydroxy-5-oxo-1,2-diphosphonooxyhexan-3-yl] dihydrogen phosphate (PubChem CID 88507978) has the molecular formula C6H15O15P3 and a molecular weight of 420.09 g/mol. Its IUPAC name is [(2S,3R,4S)-4,6-dihydroxy-5-oxo-1,2-diphosphonooxyhexan-3-yl] dihydrogen phosphate.
| Compound Name | [(2S,3R,4S)-4,6-dihydroxy-5-oxo-1,2-diphosphonooxyhexan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 88507978 |
| Molecular Formula | C6H15O15P3 |
| Molecular Weight | 420.09 g/mol |
| Exact Mass | 419.96 |
| IUPAC Name | [(2S,3R,4S)-4,6-dihydroxy-5-oxo-1,2-diphosphonooxyhexan-3-yl] dihydrogen phosphate |
| SMILES | O=C(CO)[C@@H](O)[C@@H](OP(=O)(O)O)[C@H](COP(=O)(O)O)OP(=O)(O)O |
| InChI | InChI=1S/C6H15O15P3/c7-1-3(8)5(9)6(21-24(16,17)18)4(20-23(13,14)15)2-19-22(10,11)12/h4-7,9H,1-2H2,(H2,10,11,12)(H2,13,14,15)(H2,16,17,18)/t4-,5+,6-/m0/s1 |
| InChIKey | GSAKDIFUBUAIMF-JKUQZMGJSA-N |
| XLogP | -3.03 |
| TPSA | 257.81 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.09 |
| LogP ≤ 5 | -3.03 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|