C5H12O11P2 — CID 88508016
[(2R,3R,4S)-3,4-dihydroxy-5-oxo-1-phosphonooxypentan-2-yl] dihydrogen phosphate (PubChem CID 88508016) has the molecular formula C5H12O11P2 and a molecular weight of 310.09 g/mol. Its IUPAC name is [(2R,3R,4S)-3,4-dihydroxy-5-oxo-1-phosphonooxypentan-2-yl] dihydrogen phosphate.
| Compound Name | [(2R,3R,4S)-3,4-dihydroxy-5-oxo-1-phosphonooxypentan-2-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 88508016 |
| Molecular Formula | C5H12O11P2 |
| Molecular Weight | 310.09 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | [(2R,3R,4S)-3,4-dihydroxy-5-oxo-1-phosphonooxypentan-2-yl] dihydrogen phosphate |
| SMILES | O=C[C@@H](O)[C@@H](O)[C@@H](COP(=O)(O)O)OP(=O)(O)O |
| InChI | InChI=1S/C5H12O11P2/c6-1-3(7)5(8)4(16-18(12,13)14)2-15-17(9,10)11/h1,3-5,7-8H,2H2,(H2,9,10,11)(H2,12,13,14)/t3-,4-,5-/m1/s1 |
| InChIKey | YQZKWYPGYBCNQJ-UOWFLXDJSA-N |
| XLogP | -2.51 |
| TPSA | 191.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.09 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|