C33H49ClO4 — CID 175064033
(2-chloroacetyl) 2-[(4aS,6aR,6bS,8aR,11R,12S,12aR,14aR,14bS)-4,6a,6b,8a,11,12,14b-heptamethyl-14-oxo-1,2,3,4a,5,6,7,8,9,10,11,12,12a,14a-tetradecahydropicen-4-yl]acetate (PubChem CID 175064033) has the molecular formula C33H49ClO4 and a molecular weight of 545.20 g/mol. Its IUPAC name is (2-chloroacetyl) 2-[(4aS,6aR,6bS,8aR,11R,12S,12aR,14aR,14bS)-4,6a,6b,8a,11,12,14b-heptamethyl-14-oxo-1,2,3,4a,5,6,7,8,9,10,11,12,12a,14a-tetradecahydropicen-4-yl]acetate.
| Compound Name | (2-chloroacetyl) 2-[(4aS,6aR,6bS,8aR,11R,12S,12aR,14aR,14bS)-4,6a,6b,8a,11,12,14b-heptamethyl-14-oxo-1,2,3,4a,5,6,7,8,9,10,11,12,12a,14a-tetradecahydropicen-4-yl]acetate |
|---|---|
| PubChem CID | 175064033 |
| Molecular Formula | C33H49ClO4 |
| Molecular Weight | 545.20 g/mol |
| Exact Mass | 544.33 |
| IUPAC Name | (2-chloroacetyl) 2-[(4aS,6aR,6bS,8aR,11R,12S,12aR,14aR,14bS)-4,6a,6b,8a,11,12,14b-heptamethyl-14-oxo-1,2,3,4a,5,6,7,8,9,10,11,12,12a,14a-tetradecahydropicen-4-yl]acetate |
| SMILES | C[C@H]1[C@H](C)CC[C@]2(C)CC[C@]3(C)C(=CC(=O)[C@@H]4[C@@]5(C)CCCC(C)(CC(=O)OC(=O)CCl)[C@@H]5CC[C@]43C)[C@H]12 |
| InChI | InChI=1S/C33H49ClO4/c1-20-9-13-29(3)15-16-32(6)22(27(29)21(20)2)17-23(35)28-31(5)12-8-11-30(4,18-25(36)38-26(37)19-34)24(31)10-14-33(28,32)7/h17,20-21,24,27-28H,8-16,18-19H2,1-7H3/t20-,21+,24+,27+,28-,29-,30?,31+,32-,33-/m1/s1 |
| InChIKey | LTEJAAMUHMWVPO-HQWKVESPSA-N |
| XLogP | 7.91 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.20 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|