C34H52O4 — CID 52915654
butyl (4R,4aR,6aR,6bS,8aR,11R,12S,12aR,14aR,14bS)-4,6a,6b,8a,11,12,14b-heptamethyl-3,14-dioxo-2,4a,5,6,7,8,9,10,11,12,12a,14a-dodecahydro-1H-picene-4-carboxylate (PubChem CID 52915654) has the molecular formula C34H52O4 and a molecular weight of 524.79 g/mol. Its IUPAC name is butyl (4R,4aR,6aR,6bS,8aR,11R,12S,12aR,14aR,14bS)-4,6a,6b,8a,11,12,14b-heptamethyl-3,14-dioxo-2,4a,5,6,7,8,9,10,11,12,12a,14a-dodecahydro-1H-picene-4-carboxylate.
| Compound Name | butyl (4R,4aR,6aR,6bS,8aR,11R,12S,12aR,14aR,14bS)-4,6a,6b,8a,11,12,14b-heptamethyl-3,14-dioxo-2,4a,5,6,7,8,9,10,11,12,12a,14a-dodecahydro-1H-picene-4-carboxylate |
|---|---|
| PubChem CID | 52915654 |
| Molecular Formula | C34H52O4 |
| Molecular Weight | 524.79 g/mol |
| Exact Mass | 524.39 |
| IUPAC Name | butyl (4R,4aR,6aR,6bS,8aR,11R,12S,12aR,14aR,14bS)-4,6a,6b,8a,11,12,14b-heptamethyl-3,14-dioxo-2,4a,5,6,7,8,9,10,11,12,12a,14a-dodecahydro-1H-picene-4-carboxylate |
| SMILES | CCCCOC(=O)[C@@]1(C)C(=O)CC[C@]2(C)[C@H]3C(=O)C=C4[C@@H]5[C@@H](C)[C@H](C)CC[C@]5(C)CC[C@@]4(C)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C34H52O4/c1-9-10-19-38-29(37)34(8)25-12-16-33(7)28(31(25,5)15-13-26(34)36)24(35)20-23-27-22(3)21(2)11-14-30(27,4)17-18-32(23,33)6/h20-22,25,27-28H,9-19H2,1-8H3/t21-,22+,25-,27+,28-,30-,31+,32-,33-,34-/m1/s1 |
| InChIKey | QRUBERBKAUXMQG-LVVWDAJCSA-N |
| XLogP | 7.74 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.79 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|