About 2-N,5-N-dimethyl-3-(2-methylpyrrolidin-1-yl)pyridine-2,5-diamine;quinoline
2-N,5-N-dimethyl-3-(2-methylpyrrolidin-1-yl)pyridine-2,5-diamine;quinoline (PubChem CID 175064037) has the molecular formula C21H27N5
and a molecular weight of 349.48 g/mol. Its IUPAC name is 2-N,5-N-dimethyl-3-(2-methylpyrrolidin-1-yl)pyridine-2,5-diamine;quinoline.
Molecular Properties
| Compound Name | 2-N,5-N-dimethyl-3-(2-methylpyrrolidin-1-yl)pyridine-2,5-diamine;quinoline |
| PubChem CID | 175064037 |
| Molecular Formula | C21H27N5 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | 2-N,5-N-dimethyl-3-(2-methylpyrrolidin-1-yl)pyridine-2,5-diamine;quinoline |
| SMILES | CNc1cnc(NC)c(N2CCCC2C)c1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C12H20N4.C9H7N/c1-9-5-4-6-16(9)11-7-10(13-2)8-15-12(11)14-3;1-2-6-9-8(4-1)5-3-7-10-9/h7-9,13H,4-6H2,1-3H3,(H,14,15);1-7H |
| InChIKey | HTFMHSWOENFMDK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-N,5-N-dimethyl-3-(2-methylpyrrolidin-1-yl)pyridine-2,5-diamine;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,5-N-dimethyl-3-(2-methylpyrrolidin-1-yl)pyridine-2,5-diamine;quinoline?
The IUPAC name of 2-N,5-N-dimethyl-3-(2-methylpyrrolidin-1-yl)pyridine-2,5-diamine;quinoline (CID 175064037) is 2-N,5-N-dimethyl-3-(2-methylpyrrolidin-1-yl)pyridine-2,5-diamine;quinoline.
What is the SMILES notation for 2-N,5-N-dimethyl-3-(2-methylpyrrolidin-1-yl)pyridine-2,5-diamine;quinoline?
The canonical SMILES for 2-N,5-N-dimethyl-3-(2-methylpyrrolidin-1-yl)pyridine-2,5-diamine;quinoline is CNc1cnc(NC)c(N2CCCC2C)c1.c1ccc2ncccc2c1.
What is the InChIKey of 2-N,5-N-dimethyl-3-(2-methylpyrrolidin-1-yl)pyridine-2,5-diamine;quinoline?
The InChIKey is HTFMHSWOENFMDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4.C9H7N/c1-9-5-4-6-16(9)11-7-10(13-2)8-15-12(11)14-3;1-2-6-9-8(4-1)5-3-7-10-9/h7-9,13H,4-6H2,1-3H3,(H,14,15);1-7H.
What are the key properties of 2-N,5-N-dimethyl-3-(2-methylpyrrolidin-1-yl)pyridine-2,5-diamine;quinoline?
2-N,5-N-dimethyl-3-(2-methylpyrrolidin-1-yl)pyridine-2,5-diamine;quinoline has a molecular weight of 349.48 g/mol, XLogP of 4.39, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,5-N-dimethyl-3-(2-methylpyrrolidin-1-yl)pyridine-2,5-diamine;quinoline is sourced from PubChem (CID 175064037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).