About N-methylpyridin-4-amine;quinoline
N-methylpyridin-4-amine;quinoline (PubChem CID 174890056) has the molecular formula C15H15N3
and a molecular weight of 237.31 g/mol. Its IUPAC name is N-methylpyridin-4-amine;quinoline.
Molecular Properties
| Compound Name | N-methylpyridin-4-amine;quinoline |
| PubChem CID | 174890056 |
| Molecular Formula | C15H15N3 |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | N-methylpyridin-4-amine;quinoline |
| SMILES | CNc1ccncc1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C6H8N2/c1-2-6-9-8(4-1)5-3-7-10-9;1-7-6-2-4-8-5-3-6/h1-7H;2-5H,1H3,(H,7,8) |
| InChIKey | GRAWVEMEUCCHMY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methylpyridin-4-amine;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylpyridin-4-amine;quinoline?
The IUPAC name of N-methylpyridin-4-amine;quinoline (CID 174890056) is N-methylpyridin-4-amine;quinoline.
What is the SMILES notation for N-methylpyridin-4-amine;quinoline?
The canonical SMILES for N-methylpyridin-4-amine;quinoline is CNc1ccncc1.c1ccc2ncccc2c1.
What is the InChIKey of N-methylpyridin-4-amine;quinoline?
The InChIKey is GRAWVEMEUCCHMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C6H8N2/c1-2-6-9-8(4-1)5-3-7-10-9;1-7-6-2-4-8-5-3-6/h1-7H;2-5H,1H3,(H,7,8).
What are the key properties of N-methylpyridin-4-amine;quinoline?
N-methylpyridin-4-amine;quinoline has a molecular weight of 237.31 g/mol, XLogP of 3.36, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylpyridin-4-amine;quinoline is sourced from PubChem (CID 174890056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).