C23H32ClN3O3Si — CID 175066216
piperidin-4-yl N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-N-(4-chlorophenyl)carbamate (PubChem CID 175066216) has the molecular formula C23H32ClN3O3Si and a molecular weight of 462.07 g/mol. Its IUPAC name is piperidin-4-yl N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-N-(4-chlorophenyl)carbamate.
| Compound Name | piperidin-4-yl N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-N-(4-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 175066216 |
| Molecular Formula | C23H32ClN3O3Si |
| Molecular Weight | 462.07 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | piperidin-4-yl N-[5-[tert-butyl(dimethyl)silyl]oxy-2-pyridinyl]-N-(4-chlorophenyl)carbamate |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(N(C(=O)OC2CCNCC2)c2ccc(Cl)cc2)nc1 |
| InChI | InChI=1S/C23H32ClN3O3Si/c1-23(2,3)31(4,5)30-20-10-11-21(26-16-20)27(18-8-6-17(24)7-9-18)22(28)29-19-12-14-25-15-13-19/h6-11,16,19,25H,12-15H2,1-5H3 |
| InChIKey | VYKKNAUUVTWWPA-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.07 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|