C19H15NO4 — CID 175068513
ethyl 6-cyano-4-oxo-2-phenyl-2,3-dihydrochromene-3-carboxylate (PubChem CID 175068513) has the molecular formula C19H15NO4 and a molecular weight of 321.33 g/mol. Its IUPAC name is ethyl 6-cyano-4-oxo-2-phenyl-2,3-dihydrochromene-3-carboxylate.
| Compound Name | ethyl 6-cyano-4-oxo-2-phenyl-2,3-dihydrochromene-3-carboxylate |
|---|---|
| PubChem CID | 175068513 |
| Molecular Formula | C19H15NO4 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | ethyl 6-cyano-4-oxo-2-phenyl-2,3-dihydrochromene-3-carboxylate |
| SMILES | CCOC(=O)C1C(=O)c2cc(C#N)ccc2OC1c1ccccc1 |
| InChI | InChI=1S/C19H15NO4/c1-2-23-19(22)16-17(21)14-10-12(11-20)8-9-15(14)24-18(16)13-6-4-3-5-7-13/h3-10,16,18H,2H2,1H3 |
| InChIKey | DRRWOTUBTZGPBY-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|