C34H43Br2N3O — CID 175071382
1-[4-[N,3-bis(5-bromo-3-methylpentyl)-5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylanilino]phenyl]cyclopropane-1-carbonitrile (PubChem CID 175071382) has the molecular formula C34H43Br2N3O and a molecular weight of 669.55 g/mol. Its IUPAC name is 1-[4-[N,3-bis(5-bromo-3-methylpentyl)-5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylanilino]phenyl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[4-[N,3-bis(5-bromo-3-methylpentyl)-5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylanilino]phenyl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 175071382 |
| Molecular Formula | C34H43Br2N3O |
| Molecular Weight | 669.55 g/mol |
| Exact Mass | 667.18 |
| IUPAC Name | 1-[4-[N,3-bis(5-bromo-3-methylpentyl)-5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylanilino]phenyl]cyclopropane-1-carbonitrile |
| SMILES | Cc1noc(C)c1-c1cc(CCC(C)CCBr)c(C)c(N(CCC(C)CCBr)c2ccc(C3(C#N)CC3)cc2)c1 |
| InChI | InChI=1S/C34H43Br2N3O/c1-23(12-17-35)6-7-28-20-29(33-26(4)38-40-27(33)5)21-32(25(28)3)39(19-14-24(2)13-18-36)31-10-8-30(9-11-31)34(22-37)15-16-34/h8-11,20-21,23-24H,6-7,12-19H2,1-5H3 |
| InChIKey | WUERWSMMIAGPHM-UHFFFAOYSA-N |
| XLogP | 10.13 |
| TPSA | 53.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.55 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|