C15H29N5O5 — CID 175074956
N'-[2-[2-(2-aminoethylamino)ethylamino]ethyl]ethane-1,2-diamine;3,4,5-trihydroxybenzoic acid (PubChem CID 175074956) has the molecular formula C15H29N5O5 and a molecular weight of 359.43 g/mol. Its IUPAC name is N'-[2-[2-(2-aminoethylamino)ethylamino]ethyl]ethane-1,2-diamine;3,4,5-trihydroxybenzoic acid.
| Compound Name | N'-[2-[2-(2-aminoethylamino)ethylamino]ethyl]ethane-1,2-diamine;3,4,5-trihydroxybenzoic acid |
|---|---|
| PubChem CID | 175074956 |
| Molecular Formula | C15H29N5O5 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | N'-[2-[2-(2-aminoethylamino)ethylamino]ethyl]ethane-1,2-diamine;3,4,5-trihydroxybenzoic acid |
| SMILES | NCCNCCNCCNCCN.O=C(O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C8H23N5.C7H6O5/c9-1-3-11-5-7-13-8-6-12-4-2-10;8-4-1-3(7(11)12)2-5(9)6(4)10/h11-13H,1-10H2;1-2,8-10H,(H,11,12) |
| InChIKey | VNWWANNHVOQMHB-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 186.12 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|