C18H14ClF2N3O — CID 175076903
4-[4-(4-chloro-2-fluorophenyl)-8-fluoroquinazolin-7-yl]morpholine (PubChem CID 175076903) has the molecular formula C18H14ClF2N3O and a molecular weight of 361.78 g/mol. Its IUPAC name is 4-[4-(4-chloro-2-fluorophenyl)-8-fluoroquinazolin-7-yl]morpholine.
| Compound Name | 4-[4-(4-chloro-2-fluorophenyl)-8-fluoroquinazolin-7-yl]morpholine |
|---|---|
| PubChem CID | 175076903 |
| Molecular Formula | C18H14ClF2N3O |
| Molecular Weight | 361.78 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 4-[4-(4-chloro-2-fluorophenyl)-8-fluoroquinazolin-7-yl]morpholine |
| SMILES | Fc1cc(Cl)ccc1-c1ncnc2c(F)c(N3CCOCC3)ccc12 |
| InChI | InChI=1S/C18H14ClF2N3O/c19-11-1-2-12(14(20)9-11)17-13-3-4-15(24-5-7-25-8-6-24)16(21)18(13)23-10-22-17/h1-4,9-10H,5-8H2 |
| InChIKey | AQMNKURRSDHCNA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.78 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |