C28H23BrO6 — CID 175077119
phenyl 3-bromo-4-[3-(5-hydroxy-7-methoxy-2,2-dimethylchromen-6-yl)-3-oxoprop-1-enyl]benzoate (PubChem CID 175077119) has the molecular formula C28H23BrO6 and a molecular weight of 535.39 g/mol. Its IUPAC name is phenyl 3-bromo-4-[3-(5-hydroxy-7-methoxy-2,2-dimethylchromen-6-yl)-3-oxoprop-1-enyl]benzoate.
| Compound Name | phenyl 3-bromo-4-[3-(5-hydroxy-7-methoxy-2,2-dimethylchromen-6-yl)-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 175077119 |
| Molecular Formula | C28H23BrO6 |
| Molecular Weight | 535.39 g/mol |
| Exact Mass | 534.07 |
| IUPAC Name | phenyl 3-bromo-4-[3-(5-hydroxy-7-methoxy-2,2-dimethylchromen-6-yl)-3-oxoprop-1-enyl]benzoate |
| SMILES | COc1cc2c(c(O)c1C(=O)C=Cc1ccc(C(=O)Oc3ccccc3)cc1Br)C=CC(C)(C)O2 |
| InChI | InChI=1S/C28H23BrO6/c1-28(2)14-13-20-23(35-28)16-24(33-3)25(26(20)31)22(30)12-11-17-9-10-18(15-21(17)29)27(32)34-19-7-5-4-6-8-19/h4-16,31H,1-3H3 |
| InChIKey | SHQIYWYEZHRUBE-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.39 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|