C27H25N — CID 175079054
1-(3,5-dimethylphenyl)-7,7-dimethylbenzo[g]fluoren-9-amine (PubChem CID 175079054) has the molecular formula C27H25N and a molecular weight of 363.50 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-7,7-dimethylbenzo[g]fluoren-9-amine.
| Compound Name | 1-(3,5-dimethylphenyl)-7,7-dimethylbenzo[g]fluoren-9-amine |
|---|---|
| PubChem CID | 175079054 |
| Molecular Formula | C27H25N |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-7,7-dimethylbenzo[g]fluoren-9-amine |
| SMILES | Cc1cc(C)cc(-c2cccc3ccc4c(c23)-c2ccc(N)cc2C4(C)C)c1 |
| InChI | InChI=1S/C27H25N/c1-16-12-17(2)14-19(13-16)21-7-5-6-18-8-11-23-26(25(18)21)22-10-9-20(28)15-24(22)27(23,3)4/h5-15H,28H2,1-4H3 |
| InChIKey | OJJAQUKGLUFOLE-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|