C27H30FNO4S — CID 175079881
3-[4-[2-[(3R)-3-(fluoromethyl)pyrrolidin-1-yl]ethoxy]phenoxy]-6-(oxan-2-yl)-1-benzothiophene-2-carbaldehyde (PubChem CID 175079881) has the molecular formula C27H30FNO4S and a molecular weight of 483.61 g/mol. Its IUPAC name is 3-[4-[2-[(3R)-3-(fluoromethyl)pyrrolidin-1-yl]ethoxy]phenoxy]-6-(oxan-2-yl)-1-benzothiophene-2-carbaldehyde.
| Compound Name | 3-[4-[2-[(3R)-3-(fluoromethyl)pyrrolidin-1-yl]ethoxy]phenoxy]-6-(oxan-2-yl)-1-benzothiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 175079881 |
| Molecular Formula | C27H30FNO4S |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | 3-[4-[2-[(3R)-3-(fluoromethyl)pyrrolidin-1-yl]ethoxy]phenoxy]-6-(oxan-2-yl)-1-benzothiophene-2-carbaldehyde |
| SMILES | O=Cc1sc2cc(C3CCCCO3)ccc2c1Oc1ccc(OCCN2CC[C@@H](CF)C2)cc1 |
| InChI | InChI=1S/C27H30FNO4S/c28-16-19-10-11-29(17-19)12-14-31-21-5-7-22(8-6-21)33-27-23-9-4-20(24-3-1-2-13-32-24)15-25(23)34-26(27)18-30/h4-9,15,18-19,24H,1-3,10-14,16-17H2/t19-,24?/m0/s1 |
| InChIKey | GCGICYOIXRYVPW-XGLRFROISA-N |
| XLogP | 6.42 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|