C27H29FN6O — CID 175085157
5-[(4R)-8-[(3S,4S)-4-amino-3-hydroxy-3-methylpyrrolidin-1-yl]-9-fluoro-4-methyl-3,4,6,10-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]quinoline-8-carbonitrile (PubChem CID 175085157) has the molecular formula C27H29FN6O and a molecular weight of 472.57 g/mol. Its IUPAC name is 5-[(4R)-8-[(3S,4S)-4-amino-3-hydroxy-3-methylpyrrolidin-1-yl]-9-fluoro-4-methyl-3,4,6,10-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]quinoline-8-carbonitrile.
| Compound Name | 5-[(4R)-8-[(3S,4S)-4-amino-3-hydroxy-3-methylpyrrolidin-1-yl]-9-fluoro-4-methyl-3,4,6,10-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 175085157 |
| Molecular Formula | C27H29FN6O |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | 5-[(4R)-8-[(3S,4S)-4-amino-3-hydroxy-3-methylpyrrolidin-1-yl]-9-fluoro-4-methyl-3,4,6,10-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]quinoline-8-carbonitrile |
| SMILES | C[C@@H]1CN(c2ccc(C#N)c3ncccc23)CC2=C3CC(F)=C(N4C[C@H](N)[C@@](C)(O)C4)C=C3CN21 |
| InChI | InChI=1S/C27H29FN6O/c1-16-11-32(22-6-5-17(10-29)26-19(22)4-3-7-31-26)13-24-20-9-21(28)23(8-18(20)12-34(16)24)33-14-25(30)27(2,35)15-33/h3-8,16,25,35H,9,11-15,30H2,1-2H3/t16-,25+,27+/m1/s1 |
| InChIKey | NUAICZMNANOVLO-YDZMPMGISA-N |
| XLogP | 2.79 |
| TPSA | 92.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|