C27H29FN6 — CID 175083360
5-[(4R)-8-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methylamino]-4-methyl-3,4,6,10-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]quinoline-8-carbonitrile (PubChem CID 175083360) has the molecular formula C27H29FN6 and a molecular weight of 456.57 g/mol. Its IUPAC name is 5-[(4R)-8-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methylamino]-4-methyl-3,4,6,10-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]quinoline-8-carbonitrile.
| Compound Name | 5-[(4R)-8-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methylamino]-4-methyl-3,4,6,10-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 175083360 |
| Molecular Formula | C27H29FN6 |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 5-[(4R)-8-[[(2S,4S)-4-fluoropyrrolidin-2-yl]methylamino]-4-methyl-3,4,6,10-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]quinoline-8-carbonitrile |
| SMILES | C[C@@H]1CN(c2ccc(C#N)c3ncccc23)CC2=C3CC=C(NC[C@@H]4C[C@H](F)CN4)C=C3CN21 |
| InChI | InChI=1S/C27H29FN6/c1-17-14-33(25-7-4-18(11-29)27-24(25)3-2-8-30-27)16-26-23-6-5-21(9-19(23)15-34(17)26)32-13-22-10-20(28)12-31-22/h2-5,7-9,17,20,22,31-32H,6,10,12-16H2,1H3/t17-,20+,22+/m1/s1 |
| InChIKey | KAGBJDPHYJIXPH-AGHHOFFYSA-N |
| XLogP | 3.39 |
| TPSA | 67.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|