C26H24N6 — CID 167483295
5-[(4R)-4-methyl-8-(1,2,3,6-tetrahydropyridin-4-yl)-3,4-dihydro-1H-pyrazino[1,2-b]indazol-2-yl]quinoline-8-carbonitrile (PubChem CID 167483295) has the molecular formula C26H24N6 and a molecular weight of 420.52 g/mol. Its IUPAC name is 5-[(4R)-4-methyl-8-(1,2,3,6-tetrahydropyridin-4-yl)-3,4-dihydro-1H-pyrazino[1,2-b]indazol-2-yl]quinoline-8-carbonitrile.
| Compound Name | 5-[(4R)-4-methyl-8-(1,2,3,6-tetrahydropyridin-4-yl)-3,4-dihydro-1H-pyrazino[1,2-b]indazol-2-yl]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 167483295 |
| Molecular Formula | C26H24N6 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 5-[(4R)-4-methyl-8-(1,2,3,6-tetrahydropyridin-4-yl)-3,4-dihydro-1H-pyrazino[1,2-b]indazol-2-yl]quinoline-8-carbonitrile |
| SMILES | C[C@@H]1CN(c2ccc(C#N)c3ncccc23)Cc2c3ccc(C4=CCNCC4)cc3nn21 |
| InChI | InChI=1S/C26H24N6/c1-17-15-31(24-7-5-20(14-27)26-22(24)3-2-10-29-26)16-25-21-6-4-19(13-23(21)30-32(17)25)18-8-11-28-12-9-18/h2-8,10,13,17,28H,9,11-12,15-16H2,1H3/t17-/m1/s1 |
| InChIKey | YWFOWIMPNZGZPJ-QGZVFWFLSA-N |
| XLogP | 4.41 |
| TPSA | 69.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |