C26H27FN6 — CID 175082150
5-[(4R)-8-[[(3S,4S)-4-fluoropyrrolidin-3-yl]amino]-4-methyl-3,4,6,10-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]quinoline-8-carbonitrile (PubChem CID 175082150) has the molecular formula C26H27FN6 and a molecular weight of 442.54 g/mol. Its IUPAC name is 5-[(4R)-8-[[(3S,4S)-4-fluoropyrrolidin-3-yl]amino]-4-methyl-3,4,6,10-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]quinoline-8-carbonitrile.
| Compound Name | 5-[(4R)-8-[[(3S,4S)-4-fluoropyrrolidin-3-yl]amino]-4-methyl-3,4,6,10-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 175082150 |
| Molecular Formula | C26H27FN6 |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 5-[(4R)-8-[[(3S,4S)-4-fluoropyrrolidin-3-yl]amino]-4-methyl-3,4,6,10-tetrahydro-1H-pyrazino[2,1-a]isoindol-2-yl]quinoline-8-carbonitrile |
| SMILES | C[C@@H]1CN(c2ccc(C#N)c3ncccc23)CC2=C3CC=C(N[C@H]4CNC[C@@H]4F)C=C3CN21 |
| InChI | InChI=1S/C26H27FN6/c1-16-13-32(24-7-4-17(10-28)26-21(24)3-2-8-30-26)15-25-20-6-5-19(9-18(20)14-33(16)25)31-23-12-29-11-22(23)27/h2-5,7-9,16,22-23,29,31H,6,11-15H2,1H3/t16-,22+,23+/m1/s1 |
| InChIKey | WLGAUJTXFZYEPA-XARZLDAJSA-N |
| XLogP | 3.00 |
| TPSA | 67.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|