C28H32N6 — CID 167287108
5-[(4R,11aS)-4-methyl-9-[[(3S,4S)-4-methylpyrrolidin-3-yl]amino]-1,3,4,6,11,11a-hexahydropyrazino[1,2-b]isoquinolin-2-yl]quinoline-8-carbonitrile (PubChem CID 167287108) has the molecular formula C28H32N6 and a molecular weight of 452.61 g/mol. Its IUPAC name is 5-[(4R,11aS)-4-methyl-9-[[(3S,4S)-4-methylpyrrolidin-3-yl]amino]-1,3,4,6,11,11a-hexahydropyrazino[1,2-b]isoquinolin-2-yl]quinoline-8-carbonitrile.
| Compound Name | 5-[(4R,11aS)-4-methyl-9-[[(3S,4S)-4-methylpyrrolidin-3-yl]amino]-1,3,4,6,11,11a-hexahydropyrazino[1,2-b]isoquinolin-2-yl]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 167287108 |
| Molecular Formula | C28H32N6 |
| Molecular Weight | 452.61 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | 5-[(4R,11aS)-4-methyl-9-[[(3S,4S)-4-methylpyrrolidin-3-yl]amino]-1,3,4,6,11,11a-hexahydropyrazino[1,2-b]isoquinolin-2-yl]quinoline-8-carbonitrile |
| SMILES | C[C@@H]1CN(c2ccc(C#N)c3ncccc23)C[C@@H]2Cc3cc(N[C@@H]4CNC[C@@H]4C)ccc3CN21 |
| InChI | InChI=1S/C28H32N6/c1-18-13-30-14-26(18)32-23-7-5-21-16-34-19(2)15-33(17-24(34)11-22(21)10-23)27-8-6-20(12-29)28-25(27)4-3-9-31-28/h3-10,18-19,24,26,30,32H,11,13-17H2,1-2H3/t18-,19+,24-,26+/m0/s1 |
| InChIKey | PTLGIILJWNYWLA-QLFMASBFSA-N |
| XLogP | 3.76 |
| TPSA | 67.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.61 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |