C29H32N6O3 — CID 175773791
[4-[(4R,11aS)-2-(8-cyanoquinolin-5-yl)-4-methyl-1,3,4,6,11,11a-hexahydropyrazino[1,2-b]isoquinolin-8-yl]-1,4-oxazepan-6-yl]carbamic acid (PubChem CID 175773791) has the molecular formula C29H32N6O3 and a molecular weight of 512.61 g/mol. Its IUPAC name is [4-[(4R,11aS)-2-(8-cyanoquinolin-5-yl)-4-methyl-1,3,4,6,11,11a-hexahydropyrazino[1,2-b]isoquinolin-8-yl]-1,4-oxazepan-6-yl]carbamic acid.
| Compound Name | [4-[(4R,11aS)-2-(8-cyanoquinolin-5-yl)-4-methyl-1,3,4,6,11,11a-hexahydropyrazino[1,2-b]isoquinolin-8-yl]-1,4-oxazepan-6-yl]carbamic acid |
|---|---|
| PubChem CID | 175773791 |
| Molecular Formula | C29H32N6O3 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | [4-[(4R,11aS)-2-(8-cyanoquinolin-5-yl)-4-methyl-1,3,4,6,11,11a-hexahydropyrazino[1,2-b]isoquinolin-8-yl]-1,4-oxazepan-6-yl]carbamic acid |
| SMILES | C[C@@H]1CN(c2ccc(C#N)c3ncccc23)C[C@@H]2Cc3ccc(N4CCOCC(NC(=O)O)C4)cc3CN21 |
| InChI | InChI=1S/C29H32N6O3/c1-19-14-34(27-7-5-21(13-30)28-26(27)3-2-8-31-28)17-25-11-20-4-6-24(12-22(20)15-35(19)25)33-9-10-38-18-23(16-33)32-29(36)37/h2-8,12,19,23,25,32H,9-11,14-18H2,1H3,(H,36,37)/t19-,23?,25+/m1/s1 |
| InChIKey | SNOMSWZSCAPPFL-COXFATBWSA-N |
| XLogP | 3.21 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|