C28H30N6O — CID 163820997
5-[(1S,4aS)-8-[(1R,4R)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-1-methyl-1,2,4,4a,5,11-hexahydropyrazino[2,1-c][1,4]benzoxazepin-3-yl]quinoline-8-carbonitrile (PubChem CID 163820997) has the molecular formula C28H30N6O and a molecular weight of 466.59 g/mol. Its IUPAC name is 5-[(1S,4aS)-8-[(1R,4R)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-1-methyl-1,2,4,4a,5,11-hexahydropyrazino[2,1-c][1,4]benzoxazepin-3-yl]quinoline-8-carbonitrile.
| Compound Name | 5-[(1S,4aS)-8-[(1R,4R)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-1-methyl-1,2,4,4a,5,11-hexahydropyrazino[2,1-c][1,4]benzoxazepin-3-yl]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 163820997 |
| Molecular Formula | C28H30N6O |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | 5-[(1S,4aS)-8-[(1R,4R)-2,5-diazabicyclo[2.2.1]heptan-2-yl]-1-methyl-1,2,4,4a,5,11-hexahydropyrazino[2,1-c][1,4]benzoxazepin-3-yl]quinoline-8-carbonitrile |
| SMILES | C[C@H]1CN(c2ccc(C#N)c3ncccc23)C[C@H]2COc3cc(N4C[C@H]5C[C@@H]4CN5)ccc3CN21 |
| InChI | InChI=1S/C28H30N6O/c1-18-13-32(26-7-5-19(11-29)28-25(26)3-2-8-30-28)16-24-17-35-27-10-22(6-4-20(27)14-33(18)24)34-15-21-9-23(34)12-31-21/h2-8,10,18,21,23-24,31H,9,12-17H2,1H3/t18-,21+,23+,24-/m0/s1 |
| InChIKey | NVKHQNTZZAIOTG-DAQNBYSMSA-N |
| XLogP | 3.13 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|