C32H37N7O3 — CID 175773703
[1-[4-[(4R,11aS)-2-(8-cyanoquinolin-5-yl)-4-methyl-1,3,4,6,11,11a-hexahydropyrazino[1,2-b]isoquinolin-9-yl]piperazin-1-yl]-2-methyl-1-oxopropan-2-yl] carbamate (PubChem CID 175773703) has the molecular formula C32H37N7O3 and a molecular weight of 567.69 g/mol. Its IUPAC name is [1-[4-[(4R,11aS)-2-(8-cyanoquinolin-5-yl)-4-methyl-1,3,4,6,11,11a-hexahydropyrazino[1,2-b]isoquinolin-9-yl]piperazin-1-yl]-2-methyl-1-oxopropan-2-yl] carbamate.
| Compound Name | [1-[4-[(4R,11aS)-2-(8-cyanoquinolin-5-yl)-4-methyl-1,3,4,6,11,11a-hexahydropyrazino[1,2-b]isoquinolin-9-yl]piperazin-1-yl]-2-methyl-1-oxopropan-2-yl] carbamate |
|---|---|
| PubChem CID | 175773703 |
| Molecular Formula | C32H37N7O3 |
| Molecular Weight | 567.69 g/mol |
| Exact Mass | 567.30 |
| IUPAC Name | [1-[4-[(4R,11aS)-2-(8-cyanoquinolin-5-yl)-4-methyl-1,3,4,6,11,11a-hexahydropyrazino[1,2-b]isoquinolin-9-yl]piperazin-1-yl]-2-methyl-1-oxopropan-2-yl] carbamate |
| SMILES | C[C@@H]1CN(c2ccc(C#N)c3ncccc23)C[C@@H]2Cc3cc(N4CCN(C(=O)C(C)(C)OC(N)=O)CC4)ccc3CN21 |
| InChI | InChI=1S/C32H37N7O3/c1-21-18-38(28-9-7-22(17-33)29-27(28)5-4-10-35-29)20-26-16-24-15-25(8-6-23(24)19-39(21)26)36-11-13-37(14-12-36)30(40)32(2,3)42-31(34)41/h4-10,15,21,26H,11-14,16,18-20H2,1-3H3,(H2,34,41)/t21-,26+/m1/s1 |
| InChIKey | BPZPAQBKRWCLRF-RLWLMLJZSA-N |
| XLogP | 3.26 |
| TPSA | 119.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.69 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|