C42H52N4O2 — CID 175091476
1-[10-[4-(4,6-ditert-butyl-1,3,5-triazin-2-yl)phenyl]-9-hexanoylacridin-9-yl]hexan-1-one (PubChem CID 175091476) has the molecular formula C42H52N4O2 and a molecular weight of 644.90 g/mol. Its IUPAC name is 1-[10-[4-(4,6-ditert-butyl-1,3,5-triazin-2-yl)phenyl]-9-hexanoylacridin-9-yl]hexan-1-one.
| Compound Name | 1-[10-[4-(4,6-ditert-butyl-1,3,5-triazin-2-yl)phenyl]-9-hexanoylacridin-9-yl]hexan-1-one |
|---|---|
| PubChem CID | 175091476 |
| Molecular Formula | C42H52N4O2 |
| Molecular Weight | 644.90 g/mol |
| Exact Mass | 644.41 |
| IUPAC Name | 1-[10-[4-(4,6-ditert-butyl-1,3,5-triazin-2-yl)phenyl]-9-hexanoylacridin-9-yl]hexan-1-one |
| SMILES | CCCCCC(=O)C1(C(=O)CCCCC)c2ccccc2N(c2ccc(-c3nc(C(C)(C)C)nc(C(C)(C)C)n3)cc2)c2ccccc21 |
| InChI | InChI=1S/C42H52N4O2/c1-9-11-13-23-35(47)42(36(48)24-14-12-10-2)31-19-15-17-21-33(31)46(34-22-18-16-20-32(34)42)30-27-25-29(26-28-30)37-43-38(40(3,4)5)45-39(44-37)41(6,7)8/h15-22,25-28H,9-14,23-24H2,1-8H3 |
| InChIKey | TXCFRRREIXCBEH-UHFFFAOYSA-N |
| XLogP | 10.50 |
| TPSA | 76.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.90 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|