C12H23NO15S — CID 175091793
(3R,4R,5R,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;sulfo 2,3,4,5-tetrahydroxy-6-oxohexanoate (PubChem CID 175091793) has the molecular formula C12H23NO15S and a molecular weight of 453.38 g/mol. Its IUPAC name is (3R,4R,5R,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;sulfo 2,3,4,5-tetrahydroxy-6-oxohexanoate.
| Compound Name | (3R,4R,5R,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;sulfo 2,3,4,5-tetrahydroxy-6-oxohexanoate |
|---|---|
| PubChem CID | 175091793 |
| Molecular Formula | C12H23NO15S |
| Molecular Weight | 453.38 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | (3R,4R,5R,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;sulfo 2,3,4,5-tetrahydroxy-6-oxohexanoate |
| SMILES | N[C@H]1C(O)O[C@H](CO)[C@H](O)[C@@H]1O.O=CC(O)C(O)C(O)C(O)C(=O)OS(=O)(=O)O |
| InChI | InChI=1S/C6H13NO5.C6H10O10S/c7-3-5(10)4(9)2(1-8)12-6(3)11;7-1-2(8)3(9)4(10)5(11)6(12)16-17(13,14)15/h2-6,8-11H,1,7H2;1-5,8-11H,(H,13,14,15)/t2-,3-,4+,5-,6?;/m1./s1 |
| InChIKey | WRUYUMCTGURPIY-BMZZJELJSA-N |
| XLogP | -7.28 |
| TPSA | 294.83 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.38 |
| LogP ≤ 5 | -7.28 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|