C34H35F2N5O7 — CID 175092040
4-[4-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]oxy-4-fluorocyclohexa-1,5-dien-1-yl]-1-(2-fluorophenyl)-2-oxo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide (PubChem CID 175092040) has the molecular formula C34H35F2N5O7 and a molecular weight of 663.68 g/mol. Its IUPAC name is 4-[4-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]oxy-4-fluorocyclohexa-1,5-dien-1-yl]-1-(2-fluorophenyl)-2-oxo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide.
| Compound Name | 4-[4-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]oxy-4-fluorocyclohexa-1,5-dien-1-yl]-1-(2-fluorophenyl)-2-oxo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 175092040 |
| Molecular Formula | C34H35F2N5O7 |
| Molecular Weight | 663.68 g/mol |
| Exact Mass | 663.25 |
| IUPAC Name | 4-[4-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]oxy-4-fluorocyclohexa-1,5-dien-1-yl]-1-(2-fluorophenyl)-2-oxo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carboxamide |
| SMILES | COCCOc1cc2ncnc(OC3(F)C=CC(C4CCCn5c4c(C(N)=O)c(=O)n5-c4ccccc4F)=CC3)c2cc1OCCOC |
| InChI | InChI=1S/C34H35F2N5O7/c1-44-14-16-46-27-18-23-25(19-28(27)47-17-15-45-2)38-20-39-32(23)48-34(36)11-9-21(10-12-34)22-6-5-13-40-30(22)29(31(37)42)33(43)41(40)26-8-4-3-7-24(26)35/h3-4,7-11,18-20,22H,5-6,12-17H2,1-2H3,(H2,37,42) |
| InChIKey | PSNXWOWWUBDSPL-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 141.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.68 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|