About 4-diazenylpyridin-3-ol
4-diazenylpyridin-3-ol (PubChem CID 175092686) has the molecular formula C5H5N3O
and a molecular weight of 123.11 g/mol. Its IUPAC name is 4-diazenylpyridin-3-ol.
Molecular Properties
| Compound Name | 4-diazenylpyridin-3-ol |
| PubChem CID | 175092686 |
| Molecular Formula | C5H5N3O |
| Molecular Weight | 123.11 g/mol |
| Exact Mass | 123.04 |
| IUPAC Name | 4-diazenylpyridin-3-ol |
| SMILES | [H]/N=N/c1ccncc1O |
| InChI | InChI=1S/C5H5N3O/c6-8-4-1-2-7-3-5(4)9/h1-3,6,9H/b8-6+ |
| InChIKey | INASUZCZFYQWFL-SOFGYWHQSA-N |
| XLogP | 1.45 |
| TPSA | 69.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.11 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-diazenylpyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-diazenylpyridin-3-ol?
The IUPAC name of 4-diazenylpyridin-3-ol (CID 175092686) is 4-diazenylpyridin-3-ol.
What is the SMILES notation for 4-diazenylpyridin-3-ol?
The canonical SMILES for 4-diazenylpyridin-3-ol is [H]/N=N/c1ccncc1O.
What is the InChIKey of 4-diazenylpyridin-3-ol?
The InChIKey is INASUZCZFYQWFL-SOFGYWHQSA-N. The full InChI is InChI=1S/C5H5N3O/c6-8-4-1-2-7-3-5(4)9/h1-3,6,9H/b8-6+.
What are the key properties of 4-diazenylpyridin-3-ol?
4-diazenylpyridin-3-ol has a molecular weight of 123.11 g/mol, XLogP of 1.45, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-diazenylpyridin-3-ol is sourced from PubChem (CID 175092686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).