C11H11ClN2O2 — CID 175093950
2-(4-chlorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 175093950) has the molecular formula C11H11ClN2O2 and a molecular weight of 238.67 g/mol. Its IUPAC name is 2-(4-chlorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 2-(4-chlorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 175093950 |
| Molecular Formula | C11H11ClN2O2 |
| Molecular Weight | 238.67 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 2-(4-chlorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | NC(=O)C1(C(N)=O)CC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H11ClN2O2/c12-7-3-1-6(2-4-7)8-5-11(8,9(13)15)10(14)16/h1-4,8H,5H2,(H2,13,15)(H2,14,16) |
| InChIKey | ASFUMVDSLBWTKO-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.67 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|