C15H15ClO4 — CID 3870186
6-(4-chlorophenyl)-4-methylcyclohex-3-ene-1,1-dicarboxylic acid (PubChem CID 3870186) has the molecular formula C15H15ClO4 and a molecular weight of 294.73 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-4-methylcyclohex-3-ene-1,1-dicarboxylic acid.
| Compound Name | 6-(4-chlorophenyl)-4-methylcyclohex-3-ene-1,1-dicarboxylic acid |
|---|---|
| PubChem CID | 3870186 |
| Molecular Formula | C15H15ClO4 |
| Molecular Weight | 294.73 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 6-(4-chlorophenyl)-4-methylcyclohex-3-ene-1,1-dicarboxylic acid |
| SMILES | CC1=CCC(C(=O)O)(C(=O)O)C(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C15H15ClO4/c1-9-6-7-15(13(17)18,14(19)20)12(8-9)10-2-4-11(16)5-3-10/h2-6,12H,7-8H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | KGRNBEXJRYNMBE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.73 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|